Danho
ZIMSEC A Level · J2014

Chemistry Paper 2 June 2014

Questions
36
Total marks
58
Time allowed
75 min

Sit this paper online

Questions
36
Pass mark
22
Sit this paper

Answer every question in the printed order, get marked at the end, then see the answers.

The questions

Question 101

[1 marks]periodicity and ionisation energy
Fig. 1 shows the first ionisation energies of the elements sodium to argon. The value for aluminium is lower than that for magnesium because the electron removed from aluminium
  1. Ais closer to the nucleus
  2. Bcomes from a 3p orbital, which is higher in energy than the 3s
  3. Ccomes from a completely filled 3s orbital
  4. Dexperiences a greater nuclear charge

Question 102

[1 marks]periodicity and ionisation energy
The first ionisation energy of phosphorus is greater than that of sulphur because
  1. Asulphur has a larger nuclear charge
  2. Bphosphorus has a half filled 3p subshell and sulphur has a paired 3p electron
  3. Csulphur atoms are smaller than phosphorus atoms
  4. Dphosphorus forms a stable P4P_4 molecule

Question 103

[1 marks]periodicity and ionisation energy
The element from sodium to argon with the highest melting point is
  1. Aaluminium
  2. Bsilicon
  3. Csodium
  4. Dmagnesium

Question 104

[2 marks]periodicity and ionisation energy
First ionisation energy is defined as the energy required to
  1. Aremove one mole of electrons from one mole of gaseous atoms, forming one mole of singly-charged gaseous cations.
  2. Bremove one mole of electrons from one mole of gaseous molecules, forming one mole of singly-charged molecular cations.
  3. Cadd one mole of electrons to one mole of gaseous atoms, forming one mole of singly-charged gaseous anions.
  4. Dremove one mole of electrons from one mole of gaseous unipositive ions, forming one mole of doubly-charged cations.

Question 105

[2 marks]periodicity and ionisation energy
Across period 3, from sodium to argon, the first ionisation energy generally increases from left to right because
  1. Athe shielding from inner-shell electrons increases faster than the nuclear charge across the period.
  2. Bthe nuclear charge increases while the shielding from inner shells stays roughly constant, so the outer electron is held more strongly.
  3. Cthe atomic radius increases across the period, pulling the outer electron closer to the nucleus.
  4. Dthe number of occupied electron shells increases by one at every element across the period.

Question 106

[1 marks]periodicity and ionisation energy
Write a chemical equation, including state symbols, to represent the first ionisation of magnesium.

Answer this when you sit the paper.

Question 107

[2 marks]periodicity and ionisation energy
The first ionisation energies of magnesium and calcium are 736 kJ mol-1 and 590 kJ mol-1 respectively. Calcium's value is lower than magnesium's because
  1. Acalcium's outer electron occupies the 4s orbital, which is further from the nucleus and more shielded by additional inner shells than magnesium's 3s electron.
  2. Bcalcium has a smaller nuclear charge than magnesium, so its outer electron is held less strongly.
  3. Ccalcium's outer electron occupies a 3d orbital, which is higher in energy than magnesium's 3s orbital.
  4. Dcalcium is in the same period as magnesium but has one fewer occupied shell, reducing the shielding it experiences.

Question 108

[2 marks]periodicity and ionisation energy
Periodicity, as shown by the trend in first ionisation energy from sodium to argon, is best described as
  1. Athe steady increase in atomic radius observed down any single group of the periodic table.
  2. Bthe rise in successive ionisation energies observed as more electrons are removed from one atom.
  3. Cthe recurring pattern in a physical or chemical property of the elements, repeating at regular intervals as atomic number increases across successive periods.
  4. Dthe tendency of every element within the same period to share identical chemical properties.

Question 201

[1 marks]chemical equilibrium
For the equilibrium CH4(g)+2H2O(g)⇌CO2(g)+4H2(g)CH_4(g) + 2H_2O(g) \rightleftharpoons CO_2(g) + 4H_2(g), the expression for KcK_c is
  1. A[CO2][H2]4[CH4][H2O]2\frac{[CO_2][H_2]^4}{[CH_4][H_2O]^2}
  2. B[CO2]+[H2]4[CH4]+[H2O]2\frac{[CO_2] + [H_2]^4}{[CH_4] + [H_2O]^2}
  3. C[CH4][H2O]2[CO2][H2]4\frac{[CH_4][H_2O]^2}{[CO_2][H_2]^4}
  4. D[CO2][H2][CH4][H2O]\frac{[CO_2][H_2]}{[CH_4][H_2O]}

Question 202

[1 marks]chemical equilibrium
1.5 mol of methane and 2.0 mol of steam were heated in a 5.0 dm35.0\ dm^3 flask and the equilibrium mixture contained 0.5 mol of carbon dioxide. The equilibrium concentration of hydrogen, in mol dm−3mol\,dm^{-3}, is
  1. A0.10
  2. B0.20
  3. C0.40
  4. D2.00

Question 203

[1 marks]chemical equilibrium
At equilibrium [CH4]=0.2[CH_4] = 0.2, [H2O]=0.2[H_2O] = 0.2, [CO2]=0.1[CO_2] = 0.1 and [H2]=0.4 mol dm−3[H_2] = 0.4\ mol\,dm^{-3}. The value of KcK_c is
  1. A0.32 mol−2dm60.32\ mol^{-2}dm^6
  2. B3.13 mol2dm−63.13\ mol^2dm^{-6}
  3. C0.08 mol2dm−60.08\ mol^2dm^{-6}
  4. D0.32 mol2dm−60.32\ mol^2dm^{-6}

Question 204

[3 marks]chemical equilibrium
In the equilibrium CH4(g)+2H2O(g)⇌CO2(g)+4H2(g)CH_4(g) + 2H_2O(g) \rightleftharpoons CO_2(g) + 4H_2(g), increasing the flask volume from 5.0 dm³ to 8.0 dm³ at constant temperature
  1. Alowers the total pressure, so the equilibrium shifts towards the side with more gas moles (the products), increasing the amount of hydrogen produced.
  2. Blowers the total pressure, so the equilibrium shifts towards the side with fewer gas moles (the reactants), decreasing the amount of hydrogen produced.
  3. Chas no effect on the position of equilibrium, since KcK_c itself does not change with volume, so the amount of hydrogen is unchanged.
  4. Draises the total pressure, so the equilibrium shifts towards the reactants, decreasing the amount of hydrogen produced.

Question 205

[3 marks]chemical equilibrium
The forward reaction CH4(g)+2H2O(g)⇌CO2(g)+4H2(g)CH_4(g) + 2H_2O(g) \rightleftharpoons CO_2(g) + 4H_2(g) has ΔHθ=+165 kJmol−1\Delta H^{\theta} = +165\ kJmol^{-1}. Reducing the temperature
  1. Ashifts the equilibrium towards the reactants (the exothermic direction), decreasing the amount of hydrogen produced.
  2. Bonly slows the rate of both the forward and reverse reactions equally, leaving the amount of hydrogen produced unchanged.
  3. Cshifts the equilibrium towards the products (the endothermic direction), increasing the amount of hydrogen produced.
  4. Dincreases KcK_c, since a lower temperature favours the formation of more stable products, increasing the amount of hydrogen produced.

Question 206

[1 marks]chemical equilibrium
The reaction CH4(g)+2H2O(g)⇌CO2(g)+4H2(g)CH_4(g) + 2H_2O(g) \rightleftharpoons CO_2(g) + 4H_2(g), for which ΔHθ=+165 kJmol−1\Delta H^{\theta} = +165\ kJmol^{-1}, is ___ in the forward direction.

Answer this when you sit the paper.

Question 301

[1 marks]thermochemistry / enthalpy
The standard enthalpy change of combustion is the enthalpy change when
  1. Aone mole of a fuel is burned in air at any temperature
  2. Bone gram of a substance is completely burned in oxygen
  3. Cone mole of a compound is formed from its elements
  4. Done mole of a substance is completely burned in oxygen under standard conditions

Question 302

[1 marks]thermochemistry / enthalpy
Burning pentan-2-ol raised the temperature of 250 cm3250\ cm^3 of water from 24.0 °C to 92.0 °C. Taking the density of water as 1.00 g cm−31.00\ g\,cm^{-3} and c=4.18 J g−1K−1c = 4.18\ J\,g^{-1}K^{-1}, the energy released is
  1. A71.1 kJ
  2. B96.2 kJ
  3. C284 kJ
  4. D25.1 kJ

Question 303

[1 marks]thermochemistry / enthalpy
71.1 kJ was released by burning 2.84 g of pentan-2-ol (Mr=88M_r = 88). The enthalpy change of combustion, in kJ mol−1kJ\,mol^{-1}, is
  1. A−2500-2500
  2. B−2201-2201
  3. C−1100-1100
  4. D−71.1-71.1

Question 304

[2 marks]thermochemistry / enthalpy
In a bond-energy (Hess's Law) cycle, the enthalpy change of a reaction is calculated as the sum of the bond energies of the bonds broken in the reactants minus

Answer this when you sit the paper.

Question 305

[3 marks]thermochemistry / enthalpy
A Data Booklet bond-energy calculation for the enthalpy change of combustion of pentan-2-ol typically gives a different value from one measured experimentally (e.g. by burning a sample to heat a known mass of water) because
  1. Athe bond-energy method double counts the energy released when the water product forms.
  2. Bpentan-2-ol's molecular formula is different in the two calculation methods.
  3. CData Booklet bond energies are average values taken across many different compounds, not values specific to pentan-2-ol's own actual bonds.
  4. Dthe specific heat capacity used in the experimental calculation fully corrects for any heat lost to the surroundings.

Question 401

[1 marks]organic chemistry reactions
3-hydroxypropanal, HO(CH2)2CHOHO(CH_2)_2CHO, is warmed with Tollens' reagent. The organic product is
  1. AHOOC(CH2)2COOHHOOC(CH_2)_2COOH
  2. BHOCH2CH2CH2OHHOCH_2CH_2CH_2OH
  3. CCH3CH2CHOCH_3CH_2CHO
  4. DHO(CH2)2COOHHO(CH_2)_2COOH

Question 402

[1 marks]organic chemistry reactions
3-hydroxypropanal is treated with sodium tetrahydridoborate. The organic product is
  1. Apropanal
  2. Bpropane-1,3-diol
  3. Cpropanedioic acid
  4. Dpropanoic acid

Question 403

[1 marks]organic chemistry reactions
3-bromopentane is heated under reflux with ethanolic potassium hydroxide. The type of reaction is
  1. Anucleophilic substitution
  2. Belectrophilic addition
  3. Coxidation
  4. Delimination

Question 404

[2 marks]organic chemistry reactions
Acidified potassium dichromate oxidises both the aldehyde and the primary alcohol groups of 3-hydroxypropanal, HO(CH2)2CHO, giving

Answer this when you sit the paper.

Question 405

[2 marks]organic chemistry reactions
3-bromopentane is heated with excess ammonia dissolved in ethanol, in a sealed tube. This reaction is best described as
  1. Aelimination, forming pent-2-ene.
  2. Bnucleophilic substitution, forming pentan-3-amine.
  3. Cnucleophilic substitution, forming pentan-3-ol.
  4. Dfree-radical substitution, forming a mixture of dibromopentanes.

Question 406

[1 marks]organic chemistry reactions
The reagent needed to convert 3-bromopentane into pentan-3-amine is

Answer this when you sit the paper.

Question 407

[1 marks]organic chemistry reactions
The condition needed to convert 3-bromopentane into pentan-3-amine, using excess ethanolic ammonia, is

Answer this when you sit the paper.

Question 408

[1 marks]organic chemistry reactions
The reagent needed to convert 3-bromopentane into pent-2-ene by elimination is

Answer this when you sit the paper.

Question 501

[1 marks]organic chemistry / functional groups
Adrenaline contains a carbon atom carrying four different groups. The type of isomerism it shows is
  1. Afunctional group
  2. Bcis-trans
  3. Coptical
  4. Dpositional

Question 502

[1 marks]organic chemistry / functional groups
Adrenaline contains a secondary alcohol group. Warming it with acidified potassium dichromate(VI) gives
  1. Aan aldehyde
  2. Ba carboxylic acid
  3. Can alkene
  4. Da ketone

Question 503

[1 marks]organic chemistry / functional groups
Procaine contains a primary aromatic amine group. Treating it with nitrous acid and hydrochloric acid below 10 °C, then with phenol, gives
  1. Aa white precipitate of the ammonium salt
  2. Ba yellow precipitate of triiodomethane
  3. Can orange azo dye
  4. Da colourless amide

Question 504

[3 marks]organic chemistry / functional groups
Procaine's ester group, H2N−C6H2Br2−C(=O)−O−CH2CH2N(CH2CH3)2H_2N-C_6H_2Br_2-C(=O)-O-CH_2CH_2N(CH_2CH_3)_2, is hydrolysed by aqueous NaOH. Besides the sodium salt of the substituted benzoic acid, the other organic product formed is

Answer this when you sit the paper.

Question 505

[3 marks]organic chemistry / functional groups
When an ester such as procaine's side-chain ester group is hydrolysed by aqueous NaOH, the reaction is best classified as
  1. Aacid-catalysed hydrolysis, producing a carboxylic acid and an alcohol.
  2. Besterification, producing an ester and water.
  3. Cbase-catalysed hydrolysis (saponification), producing a carboxylate salt and an alcohol.
  4. Dnucleophilic addition, producing a hemiacetal.

Question 506

[1 marks]organic chemistry / functional groups
A molecule with exactly one chiral centre, such as adrenaline, has how many optical isomers (enantiomers)?

Answer this when you sit the paper.

Question 507

[2 marks]organic chemistry / functional groups
Fig. 4 shows procaine. Besides a primary aromatic amine group and an ester group, procaine also contains a
  1. Acarboxylic acid group.
  2. Bsecondary amide group.
  3. Ctertiary amine group.
  4. Dnitro group.

Question 508

[1 marks]organic chemistry / functional groups
In Fig. 4, procaine's two bromine atoms are both positioned ortho to the

Answer this when you sit the paper.

Question 509

[1 marks]organic chemistry / functional groups
Besides its chiral CH(OH)CH(OH) carbon, adrenaline, C6H5−CH(OH)CH2NHCH3C_6H_5-CH(OH)CH_2NHCH_3, contains a secondary alcohol group and a

Answer this when you sit the paper.

The answers, and why they are the answers

Sit the paper here to see which ones you got right. Danho explains every question, keeps your score, and works without a connection.