Danho
ZIMSEC A Level · J2023

Chemistry Paper 3 June 2023

Questions
110
Total marks
150

Sit this paper online

Questions
110
Pass mark
66
Sit this paper

Answer every question in the printed order, get marked at the end, then see the answers.

The questions

Question 101

[1 marks]energetics / equilibria / atomic structure
Manganese is extracted from manganese(IV) oxide by reduction with carbon. The equation for the reduction is
  1. AMnO2+2C→Mn+2COMnO_2 + 2C \rightarrow Mn + 2CO
  2. BMnO2+C→Mn+CO2MnO_2 + C \rightarrow Mn + CO_2
  3. C2MnO2+C→2Mn+CO22MnO_2 + C \rightarrow 2Mn + CO_2
  4. DMnO2+CO→Mn+CO2MnO_2 + CO \rightarrow Mn + CO_2

Question 102

[1 marks]energetics / equilibria / atomic structure
Calculate the enthalpy change for the reaction MnO2+C→Mn+CO2MnO_2 + C \rightarrow Mn + CO_2 [ΔHf\Delta H_f: MnO2MnO_2 = −520.3 kJmol⁻¹, CO2CO_2 = −393.3 kJmol⁻¹]
  1. A−127.0 kJmol⁻¹
  2. B+127.0 kJmol⁻¹
  3. C+913.6 kJmol⁻¹
  4. D−913.6 kJmol⁻¹

Question 103

[1 marks]energetics / equilibria / atomic structure
The first six ionisation energies of an element R, in kJmol⁻¹, are 1 000, 1 840, 2 880, 4 900, 7 820 and 16 700. Element R belongs to
  1. AGroup V
  2. BGroup II
  3. CGroup III
  4. DGroup IV

Question 104

[1 marks]energetics / equilibria / atomic structure
The extraction of manganese from MnO2 by reduction with carbon is endothermic (delta H = +127.0 kJ/mol). Relative to its oxide, this means elemental manganese is
  1. Aexactly as thermodynamically stable as the manganese(IV) oxide it came from
  2. Bcompletely unaffected in stability by the sign of the measured enthalpy change
  3. Cless thermodynamically stable, since energy must be supplied to form it
  4. Dmore thermodynamically stable than the manganese(IV) oxide it was extracted from

Question 105

[1 marks]energetics / equilibria / atomic structure
Write an equation for the thermal decomposition of gaseous phosphorus(V) chloride into phosphorus(III) chloride and chlorine.

Answer this when you sit the paper.

Question 106

[2 marks]energetics / equilibria / atomic structure
0.12 mol of PCl5 in a closed 3500 cm3 vessel reaches equilibrium with 0.048 mol of PCl3 formed. Calculate the equilibrium concentration of PCl5, in mol dm-3.

Answer this when you sit the paper.

Question 107

[1 marks]energetics / equilibria / atomic structure
In the same equilibrium mixture, calculate the equilibrium concentration of PCl3 (which equals that of Cl2), in mol dm-3.

Answer this when you sit the paper.

Question 108

[2 marks]energetics / equilibria / atomic structure
Using [PCl5] = 0.0206 mol dm-3 and [PCl3] = [Cl2] = 0.0137 mol dm-3, calculate Kc for PCl5(g) <=> PCl3(g) + Cl2(g).

Answer this when you sit the paper.

Question 109

[1 marks]energetics / equilibria / atomic structure
Give the electronic configuration of the outermost shell of element R, which belongs to Group V.

Answer this when you sit the paper.

Question 110

[1 marks]energetics / equilibria / atomic structure
The large jump between the fifth and sixth ionisation energies of element R shows that R has
  1. Ano electrons remaining in its outer shell
  2. Bsix electrons in its outer shell
  3. Cfive electrons in its outer shell
  4. Dfour electrons in its outer shell

Question 201

[1 marks]stoichiometry / acid-base / electrolysis
Sodium hydrogencarbonate decomposes on heating. The equation for the reaction is
  1. A2NaHCO3→Na2O+2CO2+H2O2NaHCO_3 \rightarrow Na_2O + 2CO_2 + H_2O
  2. BNaHCO3+NaCl→Na2CO3+HClNaHCO_3 + NaCl \rightarrow Na_2CO_3 + HCl
  3. C2NaHCO3→Na2CO3+CO2+H2O2NaHCO_3 \rightarrow Na_2CO_3 + CO_2 + H_2O
  4. DNaHCO3→NaOH+CO2NaHCO_3 \rightarrow NaOH + CO_2

Question 202

[1 marks]stoichiometry / acid-base / electrolysis
A 3.00 g sample of a mixture of NaHCO3NaHCO_3 and NaCl lost 0.31 g in mass when heated. The mass of NaHCO3NaHCO_3 in the sample is [MrM_r NaHCO3NaHCO_3 = 84]
  1. A0.62 g
  2. B0.84 g
  3. C2.16 g
  4. D0.31 g

Question 203

[1 marks]stoichiometry / acid-base / electrolysis
At 30 °C a solution of sodium hydroxide has a pH of 12.50. The concentration of the sodium hydroxide is [KwK_w at 30 °C = 1.4×10−141.4 \times 10^{-14} mol²dm⁻⁶]
  1. A0.0443 moldm⁻³
  2. B0.0500 moldm⁻³
  3. C0.3160 moldm⁻³
  4. D0.0316 moldm⁻³

Question 204

[1 marks]stoichiometry / acid-base / electrolysis
A 3.00 g mixture of NaHCO3 and NaCl contains 0.84 g of NaHCO3. Calculate the mass of NaCl in the sample.

Answer this when you sit the paper.

Question 205

[1 marks]stoichiometry / acid-base / electrolysis
State one factor that affects the value of Kw for water.

Answer this when you sit the paper.

Question 206

[1 marks]stoichiometry / acid-base / electrolysis
Name one metal element commonly found as an impurity in impure nickel extracted by carbon reduction.

Answer this when you sit the paper.

Question 207

[1 marks]stoichiometry / acid-base / electrolysis
In the electrolytic purification of impure nickel, the impure nickel is made the
  1. Aelectrolyte, dissolved directly into the solution
  2. Banode, so it dissolves into solution as Ni2+ ions
  3. Csalt bridge, connecting the two half-cells
  4. Dcathode, so pure nickel deposits on it directly

Question 208

[1 marks]stoichiometry / acid-base / electrolysis
Write the half-equation for the reaction at the anode during electrolytic purification of nickel.

Answer this when you sit the paper.

Question 209

[1 marks]stoichiometry / acid-base / electrolysis
Write the half-equation for the reaction at the cathode during electrolytic purification of nickel.

Answer this when you sit the paper.

Question 210

[1 marks]stoichiometry / acid-base / electrolysis
The electrolyte used in the electrolytic purification of nickel is a solution of
  1. Asodium chloride
  2. Bcopper(II) sulphate
  3. Cdilute sulphuric acid only
  4. Dnickel(II) sulphate

Question 211

[1 marks]stoichiometry / acid-base / electrolysis
State the term for the layer of insoluble impurities, such as copper, that collects below the anode during electrolytic refining of nickel.

Answer this when you sit the paper.

Question 212

[2 marks]stoichiometry / acid-base / electrolysis
In pure water, as the temperature increases, Kw
  1. Astays exactly constant regardless of temperature
  2. Bbecomes negative once the temperature is high enough
  3. Cincreases, because the ionisation of water is endothermic
  4. Ddecreases, because the ionisation of water is endothermic

Question 301

[1 marks]kinetics / redox titration
Autocatalysis is
  1. Aa reaction that takes place without a catalyst
  2. Ba reaction catalysed by the solvent used
  3. Ca reaction catalysed by one of its own products
  4. Da reaction that is slowed down by its own products

Question 302

[1 marks]kinetics / redox titration
0.275 g of pure oxalic acid crystals, H2C2O4H_2C_2O_4, were dissolved in dilute sulphuric acid and oxidised by excess potassium manganate(VII). The volume of carbon dioxide produced at room temperature and pressure is [MrM_r H2C2O4H_2C_2O_4 = 90, molar gas volume = 24 000 cm³mol⁻¹]
  1. A146.4 cm³
  2. B292.8 cm³
  3. C366.0 cm³
  4. D73.2 cm³

Question 303

[1 marks]kinetics / redox titration
For a reaction involving A, B and C it was found that doubling [B] doubled the rate, increasing [A] by a factor of 1.5 increased the rate by a factor of 1.5, and doubling [C] had no effect on the rate. The rate equation for the reaction is
  1. Arate = k[A]2[B]k[A]^2[B]
  2. Brate = k[B][C]k[B][C]
  3. Crate = k[A][B]k[A][B]
  4. Drate = k[A][B][C]k[A][B][C]

Question 304

[1 marks]kinetics / redox titration
In the reaction between KMnO4 and oxalic acid, the oxidation states of manganese and carbon both change. This makes it a
  1. Aprecipitation reaction
  2. Bredox reaction
  3. Cacid-base reaction
  4. Daddition reaction

Question 305

[1 marks]kinetics / redox titration
0.2 g of pure KMnO4 (Mr = 158) is used in a titration. Calculate the number of moles of KMnO4.

Answer this when you sit the paper.

Question 306

[1 marks]kinetics / redox titration
0.275 g of pure H2C2O4 crystals (Mr = 90) is dissolved in dilute acid. Calculate the number of moles of H2C2O4.

Answer this when you sit the paper.

Question 307

[2 marks]kinetics / redox titration
Given 1.27x10^-3 mol KMnO4 and 3.06x10^-3 mol H2C2O4 reacting in the ratio 2 MnO4- : 5 H2C2O4, the limiting reagent is
  1. Apotassium manganate(VII)
  2. Bneither, since they react exactly
  3. Coxalic acid
  4. Dthis cannot be determined from the data given

Question 308

[1 marks]kinetics / redox titration
Comparing Experiments 2 and 3 (where [A] changes but [B] and [C] stay constant), deduce the order of reaction with respect to A.

Answer this when you sit the paper.

Question 309

[1 marks]kinetics / redox titration
Comparing Experiments 1 and 2 (where [B] changes but [A] and [C] stay constant), deduce the order of reaction with respect to B.

Answer this when you sit the paper.

Question 310

[1 marks]kinetics / redox titration
Comparing Experiments 3 and 4, deduce the order of reaction with respect to C.

Answer this when you sit the paper.

Question 311

[2 marks]kinetics / redox titration
Using Experiment 1 (rate = 1.8x10^-3 mol dm-3 s-1, [A] = 0.2 mol dm-3, [B] = 0.02 mol dm-3) and rate = k[A][B], calculate the rate constant k.

Answer this when you sit the paper.

Question 401

[1 marks]group IV / halogens / redox
The inert pair effect is
  1. Athe pairing of two electrons in the same orbital
  2. Bthe shielding of the nucleus by the inner electrons
  3. Cthe inability of d electrons to take part in bonding
  4. Dthe reluctance of the outer pair of s electrons to take part in bonding

Question 402

[1 marks]group IV / halogens / redox
A brown Group (IV) compound G turns yellow-orange on strong heating. Adding concentrated hydrochloric acid to G gives a white solid and a gas H which bleaches litmus paper. G and H are
  1. AG is PbCl2PbCl_2 and H is HCl
  2. BG is PbO2PbO_2 and H is Cl2Cl_2
  3. CG is Pb3O4Pb_3O_4 and H is O2O_2
  4. DG is PbO and H is O2O_2

Question 403

[1 marks]group IV / halogens / redox
Food salted with iodised salt turns yellowish when left standing in air. This is because
  1. Aiodide ions are reduced to iodine by water
  2. Bsodium chloride decomposes in air
  3. Ciodine reacts with the water in the food
  4. Diodide ions are oxidised to iodine by atmospheric oxygen

Question 404

[1 marks]group IV / halogens / redox
Write an equation for the thermal decomposition of lead(IV) oxide (compound G) into lead(II) oxide and oxygen.

Answer this when you sit the paper.

Question 405

[2 marks]group IV / halogens / redox
Write an equation for the reaction between lead(IV) oxide and concentrated hydrochloric acid, giving a white solid and chlorine gas.

Answer this when you sit the paper.

Question 406

[2 marks]group IV / halogens / redox
Compared with the reaction of chlorine with hydrogen, the reaction of iodine with hydrogen
  1. Ais reversible and needs heating with a platinum catalyst
  2. Bis explosive even in the dark at room temperature
  3. Cdoes not occur under any conditions at all
  4. Dproceeds faster than the chlorine reaction under UV light

Question 407

[1 marks]group IV / halogens / redox
State why hydrogen chloride is thermally more stable than hydrogen iodide.

Answer this when you sit the paper.

Question 408

[2 marks]group IV / halogens / redox
Given E(Br2/Br-) = +1.07 V and E(Fe3+/Fe2+) = +0.77 V, calculate the standard cell potential for the reaction of bromine oxidising Fe2+ to Fe3+.

Answer this when you sit the paper.

Question 409

[1 marks]group IV / halogens / redox
Comparing E(cell) for Br2 (+0.30 V) and I2 (-0.23 V), both reacting with Fe2+, the stronger oxidising agent between the two halogens is
  1. Aiodine, since it forms a more strongly coloured solution with the indicator used
  2. Bboth halogens are equally strong oxidising agents in this particular comparison
  3. Cneither halogen is able to oxidise Fe2+ under these particular conditions at all
  4. Dbromine, since only its reaction with Fe2+ gives a positive E(cell)

Question 410

[2 marks]group IV / halogens / redox
Write an equation for the oxidation of iodide ions by atmospheric oxygen in acidic conditions, giving iodine and water.

Answer this when you sit the paper.

Question 501

[1 marks]periodicity / nitrogen chemistry
Which Period 3 oxide reacts with both hydrochloric acid and aqueous sodium hydroxide?
  1. AP4O10P_4O_{10}
  2. BAl2O3Al_2O_3
  3. CMgO
  4. DSiO2SiO_2

Question 502

[1 marks]periodicity / nitrogen chemistry
The equation for the oxidation of ammonia by atmospheric oxygen in the manufacture of nitric acid is
  1. A2NH3+2O2→N2O+3H2O2NH_3 + 2O_2 \rightarrow N_2O + 3H_2O
  2. BNH3+2O2→HNO3+H2ONH_3 + 2O_2 \rightarrow HNO_3 + H_2O
  3. C4NH3+5O2→4NO+6H2O4NH_3 + 5O_2 \rightarrow 4NO + 6H_2O
  4. D4NH3+3O2→2N2+6H2O4NH_3 + 3O_2 \rightarrow 2N_2 + 6H_2O

Question 503

[1 marks]periodicity / nitrogen chemistry
Ammonium sulphate fertiliser loses its value when lime is added to the same soil because
  1. Athe sulphate is converted into a nitrate
  2. Bnitrogen is lost from the soil as ammonia gas
  3. Cthe soil becomes strongly acidic
  4. Dthe fertiliser becomes more soluble and is washed away

Question 504

[1 marks]periodicity / nitrogen chemistry
Write an equation for the reaction between magnesium oxide (a basic oxide) and hydrochloric acid.

Answer this when you sit the paper.

Question 505

[2 marks]periodicity / nitrogen chemistry
Write an equation for the reaction between silicon dioxide (an acidic oxide) and sodium hydroxide.

Answer this when you sit the paper.

Question 506

[1 marks]periodicity / nitrogen chemistry
The second ionisation energy generally increases across Period 3 from Na to Ar mainly because
  1. Athe ions formed become progressively less stable across the period
  2. Bthe atoms gain extra electron shells across the period
  3. Cnuclear charge increases while atomic (ionic) radius decreases
  4. Dshielding by inner electrons increases sharply across the period

Question 507

[2 marks]periodicity / nitrogen chemistry
Write an equation for the formation of nitric acid from nitrogen dioxide and water, in the manufacture of nitric acid.

Answer this when you sit the paper.

Question 508

[1 marks]periodicity / nitrogen chemistry
Excess nitrate ions in drinking water are linked to methaemoglobinaemia because nitrate is reduced to nitrite, which
  1. Aoxidises haemoglobin, reducing its ability to carry oxygen
  2. Bprecipitates as an insoluble salt inside the blood vessels
  3. Cbinds directly and permanently to red blood cell membranes
  4. Draises the blood pH to dangerously alkaline levels

Question 509

[1 marks]periodicity / nitrogen chemistry
Write an equation for the gentle thermal decomposition of ammonium nitrate to give dinitrogen oxide and water.

Answer this when you sit the paper.

Question 510

[2 marks]periodicity / nitrogen chemistry
Write an equation for the explosive thermal decomposition of ammonium nitrate, giving nitrogen, oxygen and water.

Answer this when you sit the paper.

Question 511

[1 marks]periodicity / nitrogen chemistry
Suggest one use of ammonium nitrate based on its explosive decomposition.

Answer this when you sit the paper.

Question 601

[1 marks]organic analysis / polymers
1.00 g of a hydrocarbon Q was vaporised at 77 °C and 100 kPa and occupied 220 cm³. The relative molecular mass of Q is [R = 8.314 JK⁻¹mol⁻¹]
  1. A66
  2. B118
  3. C132
  4. D264

Question 602

[1 marks]organic analysis / polymers
A hydrocarbon Q has an empirical formula of C5H6C_5H_6 and a relative molecular mass of 132. The molecular formula of Q is
  1. AC5H6C_5H_6
  2. BC8H10C_8H_{10}
  3. CC15H18C_{15}H_{18}
  4. DC10H12C_{10}H_{12}

Question 603

[1 marks]organic analysis / polymers
The observation made when concentrated acidified potassium manganate(VII) is refluxed with an unsaturated hydrocarbon is that
  1. Athe purple colour is decolourised
  2. Ba white precipitate is formed
  3. Cthe mixture turns green and then blue
  4. Dbrown fumes are evolved

Question 604

[1 marks]organic analysis / polymers
The reaction between hydrocarbon Q and hot acidified potassium manganate(VII) is classified as
  1. Aelectrophilic substitution onto the carbon-carbon double bond present in the ring
  2. Bhydrolysis of the hydrocarbon by the dilute aqueous acid present in the mixture
  3. Coxidation (oxidative cleavage of the carbon-carbon double bond)
  4. Dreduction of the hydrocarbon by the manganate(VII) ion under acidic conditions

Question 605

[1 marks]organic analysis / polymers
Oxidative cleavage of hydrocarbon Q with hot acidified KMnO4 gives phenylethanoic acid and one other carboxylic acid, benzoic acid. Give the molecular formula of benzoic acid.

Answer this when you sit the paper.

Question 606

[1 marks]organic analysis / polymers
State the term for the process in which many small monomer molecules join together to form a large polymer molecule.

Answer this when you sit the paper.

Question 607

[1 marks]organic analysis / polymers
Hydrocarbon Q, which contains a carbon-carbon double bond, undergoes which type of polymerisation?
  1. Aionic polymerisation, rather than radical addition polymerisation
  2. Baddition polymerisation
  3. Ccondensation polymerisation
  4. Dhydrolytic polymerisation

Question 608

[1 marks]organic analysis / polymers
State the molecular formula of hydrocarbon Q, given its empirical formula is C5H6 and its relative molecular mass is 132.

Answer this when you sit the paper.

Question 609

[2 marks]organic analysis / polymers
In the reaction between Q and acidified potassium manganate(VII), the manganate(VII) ion itself is
  1. Areduced from Mn(+7) to Mn(+2), decolourising the purple solution
  2. Bleft completely unchanged, acting only as a catalyst for the reaction
  3. Cprecipitated directly out of solution as solid manganese dioxide
  4. Doxidised from Mn(+7) to an even higher, unstable oxidation state

Question 610

[1 marks]organic analysis / polymers
Calculate the empirical formula mass of hydrocarbon Q, given its empirical formula is C5H6.

Answer this when you sit the paper.

Question 701

[1 marks]organic synthesis / acidity
A compound B has the structure C6H5CH2CH(NH2)CH(OH)CO2HC_6H_5CH_2CH(NH_2)CH(OH)CO_2H. The number of chiral centres in B is
  1. A1
  2. B2
  3. C3
  4. D4

Question 702

[1 marks]organic synthesis / acidity
A cyanohydrin is converted into the corresponding carboxylic acid. The reagents and conditions required are
  1. Awarm with aqueous sodium hydroxide
  2. Breduce with LiAlH4LiAlH_4 in dry ether
  3. Creflux with dilute sulphuric acid
  4. Dheat with PCl5PCl_5

Question 703

[1 marks]organic synthesis / acidity
P is phenylmethanol, Q is 4-methylphenol and R is benzoic acid. The order of decreasing acidity of the three compounds is
  1. AP > Q > R
  2. BQ > R > P
  3. CR > P > Q
  4. DR > Q > P

Question 704

[1 marks]organic synthesis / acidity
Name the type of reaction occurring in Step I, which converts the -CO2H group of phenylalanine into a -CHO group.

Answer this when you sit the paper.

Question 705

[1 marks]organic synthesis / acidity
Name the type of reaction occurring in Step III, which converts compound C's nitrile group into the -CO2H group of compound B.

Answer this when you sit the paper.

Question 706

[1 marks]organic synthesis / acidity
State the name of the functional group formed when HCN adds across the C=O group of the amino-aldehyde to give compound C.

Answer this when you sit the paper.

Question 707

[2 marks]organic synthesis / acidity
Benzoic acid (R) is more acidic than 4-methylphenol (Q) mainly because
  1. Athe carboxylate ion formed from R is stabilised by resonance over two oxygen atoms, more than a phenoxide ion
  2. BR simply contains a benzene ring in its structure somewhere, while Q's ring is substituted differently
  3. CR has a much larger relative molecular mass than Q, which alone accounts for the difference in acidity
  4. DR is completely insoluble in water while Q is fully soluble in water at ordinary room temperature and pressure

Question 708

[1 marks]organic synthesis / acidity
State the reagent used to distinguish benzoic acid (R) from phenylmethanol (P) and 4-methylphenol (Q) by observing effervescence.

Answer this when you sit the paper.

Question 709

[1 marks]organic synthesis / acidity
When sodium hydrogencarbonate solution is added to benzoic acid (R), the observation is
  1. Athe solution turns from colourless to purple
  2. Bno visible change occurs at all
  3. Ceffervescence, as carbon dioxide gas is released
  4. Da white precipitate forms slowly over several minutes

Question 710

[1 marks]organic synthesis / acidity
Compound M is ethanedial, OHC-CHO. State the name of the product formed when M is reduced with excess LiAlH4.

Answer this when you sit the paper.

Question 711

[1 marks]organic synthesis / acidity
When compound M (ethanedial) reacts with excess 2,4-dinitrophenylhydrazine, the observation is
  1. Aan orange precipitate forms, since both aldehyde groups react
  2. Ba colourless solution forms with no visible change at all, even after some time
  3. Ca single deep blue precipitate forms immediately upon mixing the two solutions
  4. Dvigorous effervescence is observed as a colourless gas is steadily released

Question 712

[1 marks]organic synthesis / acidity
Name the type of reaction between compound M and 2,4-dinitrophenylhydrazine.

Answer this when you sit the paper.

Question 801

[1 marks]organic synthesis / isomerism
Phenylamine is converted into benzenediazonium chloride. The reagents and conditions for this step are
  1. Aconcentrated HNO3HNO_3 and concentrated H2SO4H_2SO_4 at 55 °C
  2. BNH3NH_3 in ethanol, heated under reflux
  3. CBr2Br_2 in water at room temperature
  4. DNaNO2NaNO_2 and dilute HCl at 0–5 °C

Question 802

[1 marks]organic synthesis / isomerism
2-hydroxybenzoic acid is converted into methyl 2-hydroxybenzoate. The reagents and conditions required are
  1. Awarm with aqueous sodium hydroxide
  2. Breflux with methanol and concentrated sulphuric acid
  3. Cheat with PCl5PCl_5
  4. Dreflux with methanol and aqueous sodium carbonate

Question 803

[1 marks]organic synthesis / isomerism
The condition required for the reaction between methylcyclohexane and bromine is
  1. Aan AlCl3AlCl_3 catalyst at room temperature
  2. Baqueous conditions in the dark
  3. Cconcentrated sulphuric acid at 55 °C
  4. Dultraviolet light

Question 804

[1 marks]organic synthesis / isomerism
Name compound G, the final product of the synthetic route starting from phenylamine.

Answer this when you sit the paper.

Question 805

[1 marks]organic synthesis / isomerism
Y (reacting 1:1 with PCl5) and Z (reacting 1:2 with PCl5) are isomers of G differing in the number of reactive -OH groups present. This is an example of
  1. Astructural isomerism
  2. Boptical isomerism
  3. Cno isomerism, since they have different molecular formulae
  4. Dgeometric (cis-trans) isomerism

Question 806

[1 marks]organic synthesis / isomerism
State the observation made when compound G (which has one -OH group) reacts with PCl5.

Answer this when you sit the paper.

Question 807

[1 marks]organic synthesis / isomerism
Suggest the reagent and conditions for Step II, converting benzenediazonium chloride, D, into phenol.

Answer this when you sit the paper.

Question 808

[1 marks]organic synthesis / isomerism
Name compound D, formed when phenylamine reacts with NaNO2 and dilute HCl at 0-5 degrees C.

Answer this when you sit the paper.

Question 809

[1 marks]organic synthesis / isomerism
Name compound F, formed when E (produced by Friedel-Crafts methylation of phenol) is refluxed with KMnO4.

Answer this when you sit the paper.

Question 810

[2 marks]organic synthesis / isomerism
In the free-radical substitution of methylcyclohexane with bromine, the initiation step involves
  1. Aheterolytic fission of the Br-Br bond under UV light to give Br+ and Br- ions
  2. Bdirect addition of Br2 across a carbon-carbon bond in the ring
  3. Chomolytic fission of the Br-Br bond under UV light to give bromine radicals
  4. Dprotonation of the alkane by hydrogen bromide gas under UV light conditions

Question 811

[2 marks]organic synthesis / isomerism
Write an equation for the propagation step in which a bromine radical abstracts a hydrogen atom from methylcyclohexane, RH.

Answer this when you sit the paper.

Question 812

[1 marks]organic synthesis / isomerism
State what type of step occurs when two radicals combine to end the free-radical chain reaction between methylcyclohexane and bromine.

Answer this when you sit the paper.

Question 901

[1 marks]partition / transition metals
The partition coefficient of a solute is
  1. Athe ratio of the volumes of the two immiscible solvents used
  2. Bthe ratio of the concentrations of the solute in two immiscible solvents at equilibrium
  3. Cthe total mass of the solute extracted by a solvent
  4. Dthe mass of the solute that dissolves in a solvent at a given temperature

Question 902

[1 marks]partition / transition metals
The oxidation state of vanadium in the VO2+VO_2^+ ion is
  1. A+2
  2. B+3
  3. C+4
  4. D+5

Question 903

[1 marks]partition / transition metals
When an acidified solution of potassium manganate(VII) is added to a solution of potassium iodide
  1. Athe purple colour fades and a brown solution of iodine is formed
  2. Ba white precipitate is formed
  3. Chydrogen gas is evolved
  4. Dthe purple colour remains unchanged

Question 904

[1 marks]partition / transition metals
State the term for the distribution of a solute between two immiscible solvents in contact, once equilibrium is reached.

Answer this when you sit the paper.

Question 905

[1 marks]partition / transition metals
State one factor, other than the chemical nature of the solute and solvents, that affects the value of a partition coefficient.

Answer this when you sit the paper.

Question 906

[1 marks]partition / transition metals
A partition coefficient can also vary if the solute
  1. Ahas an unusually high melting point compared with typical organic solutes
  2. Bis coloured rather than colourless in both solvents used
  3. Chas a very small relative molecular mass compared with the solvents
  4. Dassociates or dissociates differently in the two solvents

Question 907

[1 marks]partition / transition metals
State the oxidation state of manganese in the MnO4- ion.

Answer this when you sit the paper.

Question 908

[3 marks]partition / transition metals
Which is the correctly balanced ionic equation for the reaction between acidified manganate(VII) ions and iodide ions, given the products are Mn2+ and iodine?
  1. AMnO4- + 2I- + 4H+ -> Mn2+ + I2 + 2H2O
  2. B2MnO4- + 5I- + 16H+ -> 2Mn2+ + 5I2 + 8H2O + O2
  3. C2MnO4- + 10I- + 8H+ -> 2Mn2+ + 5I2 + 4H2O
  4. D2MnO4- + 10I- + 16H+ -> 2Mn2+ + 5I2 + 8H2O

Question 909

[2 marks]partition / transition metals
Given E(MnO4-/Mn2+) = +1.51 V and E(I2/I-) = +0.54 V, calculate the standard cell potential for MnO4- oxidising I- to I2.

Answer this when you sit the paper.

Question 910

[2 marks]partition / transition metals
When Fe3+/Fe2+ is added to a mixture of acidified MnO4- and I-, the iron ions act as a
  1. Aa permanent product that remains in solution after the reaction is entirely complete
  2. Ba reducing agent that is used up completely as the reaction proceeds
  3. Ca spectator ion with no chemical role whatsoever in the reaction mixture
  4. Dhomogeneous catalyst, being oxidised then reduced back as the reaction proceeds

Question 1001

[1 marks]environmental chemistry / nanochemistry
Industries are required to keep their effluent in holding sites before releasing it because the holding sites
  1. Aallow the effluent to evaporate completely
  2. Ballow solids to settle and the effluent to be treated and tested before release
  3. Cincrease the volume of effluent produced
  4. Ddilute the effluent with rain water

Question 1002

[1 marks]environmental chemistry / nanochemistry
Heavy metal ions in mining effluent are harmful to the environment because they
  1. Aare toxic and accumulate in the bodies of living organisms
  2. Braise the pH of water bodies
  3. Cevaporate readily into the atmosphere
  4. Dare broken down quickly by bacteria

Question 1003

[1 marks]environmental chemistry / nanochemistry
Carbon nanotubes are suitable for drug delivery because they have
  1. Aa permanent electrical charge
  2. Ba very large surface area to volume ratio and a hollow structure
  3. Ca very high density
  4. Da very low melting point

Question 1004

[1 marks]environmental chemistry / nanochemistry
State one advantage of industrial effluent holding sites, other than allowing effluent to be tested before release.

Answer this when you sit the paper.

Question 1005

[1 marks]environmental chemistry / nanochemistry
Name one pollutant, other than heavy metal ions, commonly found in mining industrial effluent.

Answer this when you sit the paper.

Question 1006

[1 marks]environmental chemistry / nanochemistry
Acidic (low pH) effluent released into a river is harmful mainly because it
  1. Alowers the water's pH, killing aquatic organisms and corroding structures
  2. Bhas no measurable effect at all on organisms living in the neutral water
  3. Cimmediately evaporates from the river, leaving no lasting effect behind
  4. Draises the water's dissolved oxygen concentration to toxic levels for fish

Question 1007

[1 marks]environmental chemistry / nanochemistry
In ion exchange treatment of effluent, state what a cationic resin exchanges for the dissolved metal cations.

Answer this when you sit the paper.

Question 1008

[2 marks]environmental chemistry / nanochemistry
In ion exchange treatment of industrial effluent, the effluent is
  1. Aboiled until all of the water evaporates, leaving the pollutants behind
  2. Bmixed with an equal volume of pure water simply to dilute the pollutant concentration
  3. Cpassed through a resin bed that exchanges its ions for the dissolved pollutant ions
  4. Dfiltered through a bed of fine sand to physically remove all dissolved ions

Question 1009

[1 marks]environmental chemistry / nanochemistry
State how an ion-exchange resin is restored to use after it becomes saturated with exchanged ions.

Answer this when you sit the paper.

Question 1010

[1 marks]environmental chemistry / nanochemistry
State one characteristic property of carbon nanotubes, other than their large surface area to volume ratio, that suits them for medical drug delivery.

Answer this when you sit the paper.

Question 1011

[1 marks]environmental chemistry / nanochemistry
Surface modification of carbon nanotubes is possible mainly because
  1. Acarbon nanotubes have no surface atoms available for any kind of chemical reaction whatsoever
  2. Bcarbon nanotubes are naturally radioactive and bond readily to any living tissue
  3. Ccarbon nanotubes dissolve completely and harmlessly in ordinary blood plasma
  4. Dcarbon atoms on their surface can be chemically functionalised with target-directing groups

Question 1012

[2 marks]environmental chemistry / nanochemistry
Carbon nanotubes concentrated at a tumour site can be used in thermal therapy because they
  1. Areflect all incoming near-infrared radiation away from the tumour site entirely and completely
  2. Bchemically react with tumour cells on contact to destroy them directly
  3. Cphysically block blood flow to the tumour, starving it entirely of oxygen
  4. Dabsorb near-infrared radiation, which penetrates tissue, and re-emit it as localised heat

The answers, and why they are the answers

Sit the paper here to see which ones you got right. Danho explains every question, keeps your score, and works without a connection.